1-Piperazineethanol, 4-(4-chlorophenyl)-alpha-[(4- methoxyphenoxy)methyl]- structure
|
Common Name | 1-Piperazineethanol, 4-(4-chlorophenyl)-alpha-[(4- methoxyphenoxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 450-49-7 | Molecular Weight | 376.87700 | |
| Density | 1.219g/cm3 | Boiling Point | 552.2ºC at 760 mmHg | |
| Molecular Formula | C20H25ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.7ºC | |
| Name | 1-Piperazineethanol, 4-(4-chlorophenyl)-α-[(4- methoxyphenoxy)methyl] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 552.2ºC at 760 mmHg |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.87700 |
| Flash Point | 287.7ºC |
| Exact Mass | 376.15500 |
| PSA | 45.17000 |
| LogP | 2.91340 |
| Vapour Pressure | 5.01E-13mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | HNNUHKGIGFXJNI-UHFFFAOYSA-N |
| SMILES | COc1ccc(OCC(O)CN2CCN(c3ccc(Cl)cc3)CC2)cc1 |
|
~%
1-Piperazineeth... CAS#:450-49-7 |
| Literature: Pollard; Fernandez Journal of Organic Chemistry, 1958 , vol. 23, p. 1935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-[4-(4-Chlor-phenyl)-piperazino]-3-(4-methoxy-phenoxy)-propan-2-ol |
| 1-[4-(4-Chlor-phenyl)-piperazino]-3-phenoxy-propan-2-ol |
| 1-Phenoxy-2-hydroxy-3-(4'-p-chlorphenylpiperazino)propan |
| 1-[4-(4-chloro-phenyl)-piperazino]-3-phenoxy-propan-2-ol |
| 1-[4-(4-chloro-phenyl)-piperazin-1-yl]-3-phenoxy-propan-2-ol |
| 1-[4-(4-chloro-phenyl)-piperazino]-3-(4-methoxy-phenoxy)-propan-2-ol |