3-(benzylamino)-2-chloro-naphthalene-1,4-dione structure
|
Common Name | 3-(benzylamino)-2-chloro-naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 4497-69-2 | Molecular Weight | 297.73600 | |
| Density | 1.35g/cm3 | Boiling Point | 441.4ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
| Name | 2-(benzylamino)-3-chloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 441.4ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 220.7ºC |
| Exact Mass | 297.05600 |
| PSA | 46.17000 |
| LogP | 3.69670 |
| Index of Refraction | 1.658 |
| InChIKey | XKNFBQCDFMZPPY-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(NCc2ccccc2)C(=O)c2ccccc21 |
| HS Code | 2922399090 |
|---|
|
~88%
3-(benzylamino)... CAS#:4497-69-2 |
| Literature: Lien, Jin-Cherng; Huang, Li-Jiau; Wang, Jih-Pyang; Teng, Che-Ming; Lee, Kuo-Hsiung; Kou, Sheng-Chu Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 12 p. 2111 - 2120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Benzylamino-2-chlor-1,4-naphthochinon |