4-(tert-butyl)-N-phenylaniline structure
|
Common Name | 4-(tert-butyl)-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 4496-49-5 | Molecular Weight | 225.32900 | |
| Density | 1.014 | Boiling Point | 338.653ºC at 760 mmHg | |
| Molecular Formula | C16H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(tert-Butyl)-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.014 |
|---|---|
| Boiling Point | 338.653ºC at 760 mmHg |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.32900 |
| Exact Mass | 225.15200 |
| PSA | 12.03000 |
| LogP | 4.80070 |
| Index of Refraction | 1.581 |
| InChIKey | UOMXLEWVJZEVGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Nc2ccccc2)cc1 |
| HS Code | 2921440000 |
|---|
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-tert-butyl-N-phenylaniline |
| MFCD00443884 |