dibutan-2-yl benzene-1,2-dicarboxylate structure
|
Common Name | dibutan-2-yl benzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4489-61-6 | Molecular Weight | 278.34300 | |
| Density | 1.05g/cm3 | Boiling Point | 295.3ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | dibutan-2-yl benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 295.3ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 153.9ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 3.59720 |
| Index of Refraction | 1.496 |
| InChIKey | HAPGVMADJBQOGC-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)c1ccccc1C(=O)OC(C)CC |
| HS Code | 2917349000 |
|---|
|
~78%
dibutan-2-yl be... CAS#:4489-61-6 |
| Literature: Valizadeh; Khalili Journal of the Iranian Chemical Society, 2012 , vol. 9, # 4 p. 529 - 534 |
|
~%
dibutan-2-yl be... CAS#:4489-61-6 |
| Literature: Van Schaack Bros. Chem. Works Patent: US1848155 , 1930 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Di-sec-butyl phtalate |
| di-sec-butyl phthalate |
| Phthalsaeure-di-sec-butylester |
| phthalic acid di-sec-butyl ester |
| Phthalsaeure-di-sek.-butylester |