Diisohomoeugenol structure
|
Common Name | Diisohomoeugenol | ||
|---|---|---|---|---|
| CAS Number | 4483-47-0 | Molecular Weight | 356.45500 | |
| Density | 1.06g/cm3 | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C22H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.3ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-3-ethyl-5,6-dimethoxy-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760 mmHg |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.45500 |
| Flash Point | 111.3ºC |
| Exact Mass | 356.19900 |
| PSA | 36.92000 |
| LogP | 4.99620 |
| Index of Refraction | 1.528 |
| InChIKey | RTPSBRFMJKJZNR-UHFFFAOYSA-N |
| SMILES | CCC1c2cc(OC)c(OC)cc2C(c2ccc(OC)c(OC)c2)C1C |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (+-)-1r-ethyl-3c-(3,4-dimethoxy-phenyl)-5,6-dimethoxy-2t-methyl-indan |
| (+-)-5.6-Dimethoxy-2t-methyl-1r-aethyl-3c-(3.4-dimethoxy-phenyl)-indan |
| Diisohomoeugenol |
| (+-)-1r-Aethyl-3c-(3,4-dimethoxy-phenyl)-5,6-dimethoxy-2t-methyl-indan |