N-(5-but-2-en-2-yl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide structure
|
Common Name | N-(5-but-2-en-2-yl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 4470-37-5 | Molecular Weight | 261.23300 | |
| Density | 1.242g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-but-2-en-2-yl-1,3,4-thiadiazol-2-yl)-2-phenylacetamide |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.23300 |
| Exact Mass | 261.07500 |
| PSA | 111.78000 |
| LogP | 1.31238 |
| Index of Refraction | 1.634 |
| InChIKey | FFQUFDZWCLMJTJ-UHFFFAOYSA-N |
| SMILES | CC=C(C)c1nnc(NC(=O)Cc2ccccc2)s1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |