2-hydroxy-5-piperazin-1-ylbenzoic acid
Modify Date: 2025-08-25 13:46:25
2-hydroxy-5-piperazin-1-ylbenzoic acid structure
|
Common Name | 2-hydroxy-5-piperazin-1-ylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 446831-30-7 | Molecular Weight | 222.24000 | |
| Density | 1.317g/cm3 | Boiling Point | 486ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 247.7ºC | |
| Name | 2-hydroxy-5-piperazin-1-ylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 486ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 247.7ºC |
| Exact Mass | 222.10000 |
| PSA | 72.80000 |
| LogP | 0.89380 |
| Index of Refraction | 1.611 |
| InChIKey | DBKBWPCILQUSPL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(N2CCNCC2)ccc1O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxy-5-piperazin-1-yl-benzoic Acid |