(R)-AM1241
Modify Date: 2025-09-14 11:43:49
(R)-AM1241 structure
|
Common Name | (R)-AM1241 | ||
|---|---|---|---|---|
| CAS Number | 444912-51-0 | Molecular Weight | 503.333 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 630.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H22IN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.2±31.5 °C | |
Use of (R)-AM1241(R)-AM1241 acts as an agonist at human CB2 receptors but an inverse agonist at rat and mouse CB2 receptors. Similar to the racemate AM1241, (R)-AM1241 produces antinociception to thermal pain but not mechanical pain in rats. The pain-reducing effect of (R)-AM1241 is blocked by the CB2-specific inhibitor SR 144528 but not by either the CB1-selective inhibitor rimonabant or the opioid receptor blocker naloxone. |
| Name | (r)-am1241 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.7±55.0 °C at 760 mmHg |
| Molecular Formula | C22H22IN3O3 |
| Molecular Weight | 503.333 |
| Flash Point | 335.2±31.5 °C |
| Exact Mass | 503.070587 |
| PSA | 71.06000 |
| LogP | 4.85 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | ZUHIXXCLLBMBDW-MRXNPFEDSA-N |
| SMILES | CN1CCCCC1Cn1cc(C(=O)c2cc([N+](=O)[O-])ccc2I)c2ccccc21 |
| (2-iodo-5-nitrophenyl){1-[(1-methylpiperidin-2-yl)methyl]-1H-indol-3-yl}methanone |
| Methanone, (2-iodo-5-nitrophenyl)[1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl]- |
| (2-Iodo-5-nitrophenyl){1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl}methanone |
| UNII:DLM851L3RD |