2-furylmethyl 4-nitrobenzoate
Modify Date: 2025-09-20 17:52:48
2-furylmethyl 4-nitrobenzoate structure
|
Common Name | 2-furylmethyl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 4449-29-0 | Molecular Weight | 247.20400 | |
| Density | 1.353g/cm3 | Boiling Point | 400ºC at 760 mmHg | |
| Molecular Formula | C12H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.7ºC | |
| Name | furan-2-ylmethyl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760 mmHg |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.20400 |
| Flash Point | 195.7ºC |
| Exact Mass | 247.04800 |
| PSA | 85.26000 |
| LogP | 3.06800 |
| Index of Refraction | 1.586 |
| InChIKey | NBGFOLAMLIIQHO-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccco1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Furfuryl-(4-nitro-benzoat) |
| 4-Nitro-benzoesaeure-furfurylester |
| 4-nitro-benzoic acid furfuryl ester |