1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)butan-1-one structure
|
Common Name | 1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 444111-26-6 | Molecular Weight | 221.25200 | |
| Density | 1.194g/cm3 | Boiling Point | 399.9ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.6ºC | |
| Name | 1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 399.9ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 204.6ºC |
| Exact Mass | 221.10500 |
| PSA | 61.55000 |
| LogP | 2.60400 |
| Index of Refraction | 1.567 |
| InChIKey | SSWOJWLEQYQHCP-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1cc2c(cc1N)OCCO2 |
| HS Code | 2932999099 |
|---|
|
~81%
1-(6-amino-2,3-... CAS#:444111-26-6 |
| Literature: Trofimova; Archegov; Fedotov; Gazzaeva; Mochalov; Zefirov Chemistry of Heterocyclic Compounds, 2009 , vol. 45, # 9 p. 1095 - 1104 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-7-butyroyl-1,4-benzodioxane |
| HMS1694O02 |