DBB-0920
Modify Date: 2025-08-25 18:42:57
DBB-0920 structure
|
Common Name | DBB-0920 | ||
|---|---|---|---|---|
| CAS Number | 4440-92-0 | Molecular Weight | 386.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBB-0920DBB-0920, CAS#4440-92-0, is a dibenzene-butanedione derivative nad a useful intermediate for chemical synthesis of terameprocol and a number of biologically important molecules. |
| Name | 1,4-bis(3,4-dimethoxyphenyl),2,3-dimethylbutane-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H26O6 |
|---|---|
| Molecular Weight | 386.43800 |
| Exact Mass | 386.17300 |
| PSA | 71.06000 |
| LogP | 4.05880 |
| InChIKey | SPBNPRXRUYBFDV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(C)C(C)C(=O)c2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2914509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:24150-24-1| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-butanedione |