(8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine
Modify Date: 2025-09-17 17:14:25
![(8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine Structure](https://image.chemsrc.com/caspic/030/443687-93-2.png)
(8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine structure
|
Common Name | (8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 443687-93-2 | Molecular Weight | 247.333 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 380.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3±35.2 °C | |
| Name | (8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.3±42.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.333 |
| Flash Point | 202.3±35.2 °C |
| Exact Mass | 247.157227 |
| PSA | 44.48000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | IHVLVGYHVPQYKR-UHFFFAOYSA-N |
| SMILES | NCC1(c2ccccc2)CCC2(CC1)OCCO2 |
| HS Code | 2932999099 |
|---|
|
~90%
(8-Phenyl-1,4-d... CAS#:443687-93-2 |
| Literature: Johnson, James A.; Lloyd, John; Kover, Alexander Patent: US2005/250783 A1, 2005 ; Location in patent: Page/Page column 18 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-methoxy-N-[(4-oxo-1-phenylcyclohexyl)methyl]benzamide structure](https://image.chemsrc.com/caspic/099/265656-18-6.png)
CAS#:265656-18-6| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Dioxaspiro[4.5]decane-8-methanamine, 8-phenyl- |
| 2-Methyl-5-aminomethyl-pyridin |
| 6-METHYL-3-PYRIDINEMETHANAMINE |
| 1-(8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine |
| 4-aminomethyl-4-phenylcyclohexanone ethyleneglycol ketal |
| 3-AMINOMETHYL-6-METHYLPYRIDINE |
| (8-Phenyl-1,4-dioxaspiro[4.5]dec-8-yl)methanamine |