Isopedicin structure
|
Common Name | Isopedicin | ||
|---|---|---|---|---|
| CAS Number | 4431-42-9 | Molecular Weight | 330.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 552.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8±23.6 °C | |
Use of IsopedicinIsopedicin potently and concentration-dependently inhibits superoxide anion (O2 U?) production in formyl-L-methionyl-L-leucyl-L-phenylalanine (FMLP)-activated cells. Isopedicin increases cAMP formation and PKA activity in FMLP-activated cells by inhibiting phosphodiesterase (PDE) activity[1]. |
| Name | 2,4,6-Trimethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Isopedicin potently and concentration-dependently inhibits superoxide anion (O2 U?) production in formyl-L-methionyl-L-leucyl-L-phenylalanine (FMLP)-activated cells. Isopedicin increases cAMP formation and PKA activity in FMLP-activated cells by inhibiting phosphodiesterase (PDE) activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 552.9±50.0 °C at 760 mmHg |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.33 |
| Flash Point | 202.8±23.6 °C |
| Exact Mass | 330.110352 |
| PSA | 74.22000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | CSVYPJWNGKLMJM-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(OC)c2c(c1OC)OC(c1ccccc1)CC2=O |
| 6-Hydroxy-5,7,8-trimethoxy-2-phenyl-chroman-4-on |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-6-hydroxy-5,7,8-trimethoxy-2-phenyl-, (2S)- |
| 6-Hydroxy-5,5-dimethyl-5,6-dihydro-benz<c>acridin |
| 5,5-Dimethyl-6-hydroxy-5,6-dihydrobenz<c>acridin |
| 6-hydroxy-5,7,8-trimethoxy-2-phenyl-chroman-4-one |
| (2S)-6-Hydroxy-5,7,8-trimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |