7-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one structure
|
Common Name | 7-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 442531-33-1 | Molecular Weight | 273.51400 | |
| Density | 1.76 | Boiling Point | 322.8ºC at 760 mmHg | |
| Molecular Formula | C9H6BrClN2O | Melting Point | 175ºC | |
| MSDS | N/A | Flash Point | 149ºC | |
| Name | 7-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76 |
|---|---|
| Boiling Point | 322.8ºC at 760 mmHg |
| Melting Point | 175ºC |
| Molecular Formula | C9H6BrClN2O |
| Molecular Weight | 273.51400 |
| Flash Point | 149ºC |
| Exact Mass | 271.93500 |
| PSA | 34.37000 |
| LogP | 2.19580 |
| Index of Refraction | 1.684 |
| InChIKey | HKULCEKJGGNDSO-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)nc2ccc(Br)cn12 |
| HS Code | 2933990090 |
|---|
|
~81%
7-bromo-2-(chlo... CAS#:442531-33-1 |
| Literature: Montana, Marc; Crozet, Maxime D.; Castera-Ducros, Caroline; Terme, Thierry; Vanelle, Patrice Heterocycles, 2008 , vol. 75, # 4 p. 925 - 932 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Bromo-2-chloromethyl-pyrido[1,2-a]pyrimidin-4-one |
| 7-Bromo-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one |