4-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide
Modify Date: 2025-11-16 10:12:52
![4-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/240/442157-30-4.png)
4-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide structure
|
Common Name | 4-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 442157-30-4 | Molecular Weight | 327.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide |
|---|
| Molecular Formula | C15H12F3NO2S |
|---|---|
| Molecular Weight | 327.32100 |
| Exact Mass | 327.05400 |
| PSA | 54.88000 |
| LogP | 4.90240 |
| InChIKey | SAJBDHWSYJYTQS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N=Cc2cccc(C(F)(F)F)c2)cc1 |
|
~33%
4-methyl-N-[[3-... CAS#:442157-30-4 |
| Literature: Ueno, Satoshi; Ohtsubo, Masakazu; Kuwano, Ryoichi Journal of the American Chemical Society, 2009 , vol. 131, # 36 p. 12904 - 12905 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |