methyl 5-(2,4-dioxopyrimidin-1-yl)pentanoate structure
|
Common Name | methyl 5-(2,4-dioxopyrimidin-1-yl)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 4418-25-1 | Molecular Weight | 226.22900 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-(2,4-dioxopyrimidin-1-yl)pentanoate |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.22900 |
| Exact Mass | 226.09500 |
| PSA | 81.16000 |
| Index of Refraction | 1.498 |
| InChIKey | GCSVOCCUABZMOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCn1ccc(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |