N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)butanamide
Modify Date: 2025-09-13 07:15:02
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)butanamide structure
|
Common Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 4417-84-9 | Molecular Weight | 273.33000 | |
| Density | 1.2g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33000 |
| Exact Mass | 273.14800 |
| PSA | 59.52000 |
| LogP | 2.87250 |
| Index of Refraction | 1.599 |
| InChIKey | JGZUSQFCBCRNRC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Phenyl-2,3-dimethyl-4-butyrylamino-5-pyrazolone |
| 4-butyrylamino-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one |
| BUTYRAMIDE,N-ANTIPYRINYL |
| 4-Butyrylamino-antipyrin |
| N-Antipyrinylbutyramide |