N-(4-Nitrophenyl)-3-(trifluoromethyl)benzamide structure
|
Common Name | N-(4-Nitrophenyl)-3-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 441053-37-8 | Molecular Weight | 310.22800 | |
| Density | 1.452 | Boiling Point | 343.5ºC at 760 mmHg | |
| Molecular Formula | C14H9F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.6ºC | |
| Name | N-(4-Nitrophenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452 |
|---|---|
| Boiling Point | 343.5ºC at 760 mmHg |
| Molecular Formula | C14H9F3N2O3 |
| Molecular Weight | 310.22800 |
| Flash Point | 161.6ºC |
| Exact Mass | 310.05700 |
| PSA | 74.92000 |
| LogP | 4.46210 |
| Index of Refraction | 1.592 |
| InChIKey | GJJPSRMCVUHTHT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1cccc(C(F)(F)F)c1 |
|
~78%
N-(4-Nitropheny... CAS#:441053-37-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 8 p. 2400 - 2411 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(4-nitrophenyl)-3-trifluoromethylbenzamide |
| N-(4-nitrophenyl)[3-(trifluoromethyl)phenyl]carboxamide |