2-amino-4-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenol
Modify Date: 2025-09-23 19:28:31
![2-amino-4-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenol Structure](https://image.chemsrc.com/caspic/460/4406-60-4.png)
2-amino-4-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenol structure
|
Common Name | 2-amino-4-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 4406-60-4 | Molecular Weight | 305.24900 | |
| Density | N/A | Boiling Point | 497.4ºC at 760 mmHg | |
| Molecular Formula | C9H12AsNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6ºC | |
| Name | 2-amino-4-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenol |
|---|
| Boiling Point | 497.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H12AsNO2S2 |
| Molecular Weight | 305.24900 |
| Flash Point | 254.6ºC |
| Exact Mass | 304.95300 |
| PSA | 117.08000 |
| LogP | 1.09170 |
| InChIKey | VMTDZYVXHMNQPW-UHFFFAOYSA-N |
| SMILES | Nc1cc([As]2SCC(CO)S2)ccc1O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |