trimethyl-(4-nitrophenyl)silane structure
|
Common Name | trimethyl-(4-nitrophenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 4405-33-8 | Molecular Weight | 195.29100 | |
| Density | 1.04g/cm3 | Boiling Point | 258.1ºC at 760 mmHg | |
| Molecular Formula | C9H13NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.9ºC | |
| Name | trimethyl-(4-nitrophenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 258.1ºC at 760 mmHg |
| Molecular Formula | C9H13NO2Si |
| Molecular Weight | 195.29100 |
| Flash Point | 109.9ºC |
| Exact Mass | 195.07200 |
| PSA | 45.82000 |
| LogP | 2.66320 |
| Index of Refraction | 1.504 |
| InChIKey | IJGJSNAIGBFOTK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethyl-p-nitrophenylsilane |