3-[(4-fluorobenzoyl)amino]propanoic acid
Modify Date: 2025-08-26 16:48:32
![3-[(4-fluorobenzoyl)amino]propanoic acid Structure](https://image.chemsrc.com/caspic/166/440341-64-0.png)
3-[(4-fluorobenzoyl)amino]propanoic acid structure
|
Common Name | 3-[(4-fluorobenzoyl)amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 440341-64-0 | Molecular Weight | 211.19000 | |
| Density | 1.306g/cm3 | Boiling Point | 436.6ºC at 760 mmHg | |
| Molecular Formula | C10H10FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | 3-[(4-fluorobenzoyl)amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760 mmHg |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19000 |
| Flash Point | 217.9ºC |
| Exact Mass | 211.06400 |
| PSA | 66.40000 |
| LogP | 1.42110 |
| Index of Refraction | 1.539 |
| InChIKey | PJBOGHUSZFFYNT-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNC(=O)c1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~96%
3-[(4-fluoroben... CAS#:440341-64-0 |
| Literature: Behnken, Swantje; Lincke, Thorger; Kloss, Florian; Ishida, Keishi; Hertweck, Christian Angewandte Chemie - International Edition, 2012 , vol. 51, # 10 p. 2425 - 2428 |
|
~%
3-[(4-fluoroben... CAS#:440341-64-0 |
| Literature: Behnken, Swantje; Lincke, Thorger; Kloss, Florian; Ishida, Keishi; Hertweck, Christian Angewandte Chemie - International Edition, 2012 , vol. 51, # 10 p. 2425 - 2428 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(4-fluorophenyl)formamido]propanoic acid |
| 3-(4-fluorobenzamido)propanoic acid |
| 3-[(4-fluorophenyl)carbonylamino]propanoic acid |