[(1-amino-2,2,3,3,3-pentafluoro-propylidene)amino] 2,2,3,3,3-pentafluoropropanoate structure
|
Common Name | [(1-amino-2,2,3,3,3-pentafluoro-propylidene)amino] 2,2,3,3,3-pentafluoropropanoate | ||
|---|---|---|---|---|
| CAS Number | 4396-71-8 | Molecular Weight | 324.07600 | |
| Density | 1.75g/cm3 | Boiling Point | 136.4ºC at 760 mmHg | |
| Molecular Formula | C6H2F10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 36.3ºC | |
| Name | O-<2,2,3,3,3-Pentafluor-propionyl>-2,2,3,3,3-pentafluor-propionsaeureamidoxim |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 136.4ºC at 760 mmHg |
| Molecular Formula | C6H2F10N2O2 |
| Molecular Weight | 324.07600 |
| Flash Point | 36.3ºC |
| Exact Mass | 323.99600 |
| PSA | 62.18000 |
| LogP | 2.89730 |
| Index of Refraction | 1.334 |
| InChIKey | QFKHJHWAPCCYTQ-UHFFFAOYSA-N |
| SMILES | NC(=NOC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
|
~%
[(1-amino-2,2,3... CAS#:4396-71-8 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,2,3,3,3-pentafluoro-N-pentafluoropropionyloxy-propionamidine |