Nixylic acid structure
|
Common Name | Nixylic acid | ||
|---|---|---|---|---|
| CAS Number | 4394-05-2 | Molecular Weight | 242.27300 | |
| Density | 1.25 g/cm3 | Boiling Point | 403.2ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25 g/cm3 |
|---|---|
| Boiling Point | 403.2ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Exact Mass | 242.10600 |
| PSA | 62.22000 |
| LogP | 3.21320 |
| Index of Refraction | 1.645 |
| InChIKey | XEQIPELDMSEBJG-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Nc2ncccc2C(=O)O)c1C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[(2,3-dimethylphenyl)amino]pyridine-3-carboxylic acid |
| 2-((2,3-dimethylphenyl)amino)nicotinic acid |
| 2-(2,3-Dimethyl-anilino)-nicotinsaeure |
| 2-(2,3-xylidino)-nicotinic acid |
| Nixylsaeure |
| 2-(2,3-dimethyl-anilino)-nicotinic acid |
| Nixylic acid |