8-Methyl-2-(3-methylphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 8-Methyl-2-(3-methylphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 438225-30-0 | Molecular Weight | 277.31700 | |
| Density | 1.22g/cm3 | Boiling Point | 470.7ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | 8-Methyl-2-(3-methylphenyl)quinoline-4-carboxylic acid |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760 mmHg |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.31700 |
| Flash Point | 238.5ºC |
| Exact Mass | 277.11000 |
| PSA | 50.19000 |
| LogP | 4.21680 |
| Index of Refraction | 1.655 |
| InChIKey | STEZHJHHVQYNQZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2cc(C(=O)O)c3cccc(C)c3n2)c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |