Benzoicacid, 4-[[(4-methoxyphenyl)methylene]amino]- structure
|
Common Name | Benzoicacid, 4-[[(4-methoxyphenyl)methylene]amino]- | ||
|---|---|---|---|---|
| CAS Number | 4380-38-5 | Molecular Weight | 255.26900 | |
| Density | 1.14g/cm3 | Boiling Point | 455.5ºC at 760mmHg | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | 4-[(4-methoxyphenyl)methylideneamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760mmHg |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.26900 |
| Flash Point | 229.3ºC |
| Exact Mass | 255.09000 |
| PSA | 58.89000 |
| LogP | 3.14400 |
| Index of Refraction | 1.567 |
| InChIKey | ATXBWEWYPPSELE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2925290090 |
|---|
|
~40%
Benzoicacid, 4-... CAS#:4380-38-5 |
| Literature: Walsh; Meegan; Prendergast; Al Nakib European Journal of Medicinal Chemistry, 1996 , vol. 31, # 12 p. 989 - 1000 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Anisylidenamino-benzoesaeure |
| 4-(4-methoxy-benzylidenamino)-benzoic acid |
| 4-{[(E)-(4-methoxyphenyl)methylidene]amino}benzoic acid |
| 4-(4-Methoxy-benzylidenamino)-benzoesaeure |
| 4-Anisalamino-benzoesaeure |
| 4-methoxybenzylidene-4'-carboxyaniline |