tert-butyl 4-(6-aminopyrimidin-4-yl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(6-aminopyrimidin-4-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 436851-80-8 | Molecular Weight | 279.33800 | |
| Density | 1.222g/cm3 | Boiling Point | 472.324ºC at 760 mmHg | |
| Molecular Formula | C13H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.453ºC | |
| Name | tert-butyl 4-(6-aminopyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 472.324ºC at 760 mmHg |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.33800 |
| Flash Point | 239.453ºC |
| Exact Mass | 279.17000 |
| PSA | 84.58000 |
| LogP | 1.70000 |
| Index of Refraction | 1.572 |
| InChIKey | JOZCBLMCQBMONN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(N)ncn2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-4-(6-Aminopyrimidin-4-yl)piperazine |