N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(4-methylphenoxy)acetamide structure
|
Common Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(4-methylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 4362-39-4 | Molecular Weight | 379.81800 | |
| Density | 1.453g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-chloro-3-nitrophenyl)carbamothioyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Molecular Formula | C16H14ClN3O4S |
| Molecular Weight | 379.81800 |
| Exact Mass | 379.03900 |
| PSA | 138.80000 |
| LogP | 5.03260 |
| Index of Refraction | 1.678 |
| InChIKey | OOHZLJQLODPNET-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC(=O)NC(=S)Nc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| HS Code | 2932999099 |
|---|
|
~%
N-[(4-chloro-3-... CAS#:4362-39-4 |
| Literature: Comm. Solv. Corp. Patent: US2260261 , 1940 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloromethyl-2,4-dimethyl-[1,3]dioxolane |
| 1-(4-Chloro-3-nitro-phenyl)-3-(2-p-tolyloxy-acetyl)-thiourea |
| 2-Chlormethyl-2,4-dimethyl-[1,3]dioxolan |