[3,4,5,6-tetraacetyloxy-1,1-bis(phenylmethoxy)hexan-2-yl] acetate
Modify Date: 2025-09-19 19:56:05
![[3,4,5,6-tetraacetyloxy-1,1-bis(phenylmethoxy)hexan-2-yl] acetate Structure](https://image.chemsrc.com/caspic/128/4356-97-2.png)
[3,4,5,6-tetraacetyloxy-1,1-bis(phenylmethoxy)hexan-2-yl] acetate structure
|
Common Name | [3,4,5,6-tetraacetyloxy-1,1-bis(phenylmethoxy)hexan-2-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 4356-97-2 | Molecular Weight | 588.60000 | |
| Density | 1.228g/cm3 | Boiling Point | 626.9ºC at 760 mmHg | |
| Molecular Formula | C30H36O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.9ºC | |
| Name | [2,3,4,5-tetraacetyloxy-6,6-bis(phenylmethoxy)hexyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 626.9ºC at 760 mmHg |
| Molecular Formula | C30H36O12 |
| Molecular Weight | 588.60000 |
| Flash Point | 259.9ºC |
| Exact Mass | 588.22100 |
| PSA | 149.96000 |
| LogP | 3.03600 |
| Index of Refraction | 1.523 |
| InChIKey | BXUMPCPEVFVVPT-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 6,6-bis(benzyloxy)hexane-1,2,3,4,5-pentayl pentaacetate(non-preferred name) |