5-diethylaminomethyl-2-phenyl-furan-3-carboxylic acid
Modify Date: 2025-09-17 00:40:18
5-diethylaminomethyl-2-phenyl-furan-3-carboxylic acid structure
|
Common Name | 5-diethylaminomethyl-2-phenyl-furan-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 435341-94-9 | Molecular Weight | 273.32700 | |
| Density | 1.14g/cm3 | Boiling Point | 372.8ºC at 760 mmHg | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3ºC | |
| Name | 5-diethylaminomethyl-2-phenyl-furan-3-carboxylic acid |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760 mmHg |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.32700 |
| Flash Point | 179.3ºC |
| Exact Mass | 273.13600 |
| PSA | 53.68000 |
| LogP | 3.48660 |
| Index of Refraction | 1.557 |
| InChIKey | JHOVMQMLNCCFTP-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1cc(C(=O)O)c(-c2ccccc2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |