6-(2-Phenylethenyl)-2,4,5-pyrimidinetriamine structure
|
Common Name | 6-(2-Phenylethenyl)-2,4,5-pyrimidinetriamine | ||
|---|---|---|---|---|
| CAS Number | 4350-35-0 | Molecular Weight | 227.26500 | |
| Density | 1.369g/cm3 | Boiling Point | 542ºC at 760 mmHg | |
| Molecular Formula | C12H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.4ºC | |
| Name | 6-(2-phenylethenyl)pyrimidine-2,4,5-triamine |
|---|
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 542ºC at 760 mmHg |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.26500 |
| Flash Point | 315.4ºC |
| Exact Mass | 227.11700 |
| PSA | 103.84000 |
| LogP | 3.13720 |
| Index of Refraction | 1.824 |
| InChIKey | IQUVMOWIZMLZIA-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N)c(C=Cc2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
6-(2-Phenylethe... CAS#:4350-35-0 |
| Literature: Ross Journal of the Chemical Society, 1948 , p. 1128,1132 |
|
~%
6-(2-Phenylethe... CAS#:4350-35-0 |
| Literature: Ross Journal of the Chemical Society, 1948 , p. 1128,1132 |
|
~%
6-(2-Phenylethe... CAS#:4350-35-0 |
| Literature: Ross Journal of the Chemical Society, 1948 , p. 1128,1132 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |