Benzenesulfonicacid, 4-nitro-, potassium salt (1:1)
Modify Date: 2025-09-01 18:08:29
Benzenesulfonicacid, 4-nitro-, potassium salt (1:1) structure
|
Common Name | Benzenesulfonicacid, 4-nitro-, potassium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4346-49-0 | Molecular Weight | 242.27100 | |
| Density | 1.637g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H5KNO5S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,4-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.637g/cm3 |
|---|---|
| Molecular Formula | C6H5KNO5S+ |
| Molecular Weight | 242.27100 |
| Exact Mass | 241.95300 |
| PSA | 108.57000 |
| LogP | 2.44550 |
| InChIKey | FERODINMFGAWHO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1.[K+] |
|
~56%
Benzenesulfonic... CAS#:4346-49-0 |
| Literature: Dutov; Serushkina; Shevelev Russian Journal of Organic Chemistry, 2007 , vol. 43, # 8 p. 1167 - 1169 |
|
~%
Benzenesulfonic... CAS#:4346-49-0 |
| Literature: Bunting, John W.; Mason, Jacqueline M.; Heo, Christina K. M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 11 p. 2291 - 2300 |
![Acetic acid,2-[(4-nitrophenyl)thio]-, methyl ester structure](https://image.chemsrc.com/caspic/343/6625-35-0.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Kalium-4-nitro-benzol-sulfonat |
| potassium 4-nitrophenylsulfonate |