2-amino-5-anilino-5-oxopentanoic acid
Modify Date: 2025-08-27 09:08:03
2-amino-5-anilino-5-oxopentanoic acid structure
|
Common Name | 2-amino-5-anilino-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4337-38-6 | Molecular Weight | 222.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-anilino-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O3 |
|---|---|
| Molecular Weight | 222.24000 |
| Exact Mass | 222.10000 |
| PSA | 95.91000 |
| LogP | 2.16700 |
| InChIKey | VMNRUJGOLBSEPK-UHFFFAOYSA-N |
| SMILES | NC(CCC(=O)Nc1ccccc1)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
~%
2-amino-5-anili... CAS#:4337-38-6 |
| Literature: Fittkau,S. et al. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1960 , vol. 322, p. 101 - 111 |
|
~%
2-amino-5-anili... CAS#:4337-38-6 |
| Literature: E.Lilly and Co. Patent: US2873294 , 1958 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N5-phenyl-DL-glutamine |
| DL-Glutamic acid |A-anilide |