5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid structure
|
Common Name | 5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 433283-22-8 | Molecular Weight | 237.250 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 376.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H8FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.5±23.7 °C | |
| Name | 5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.5±27.0 °C at 760 mmHg |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.250 |
| Flash Point | 181.5±23.7 °C |
| Exact Mass | 237.025970 |
| PSA | 78.43000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | XYIAPLYZWWLUBC-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(=O)O)c(-c2ccc(F)cc2)s1 |
| HS Code | 2934100090 |
|---|
|
~93%
5-(4-fluorophen... CAS#:433283-22-8 |
| Literature: Actelion Pharmaceuticals Ltd. Patent: US2010/222600 A1, 2010 ; Location in patent: Page/Page column 23 ; US 20100222600 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Thiazolecarboxylic acid, 5-(4-fluorophenyl)-2-methyl- |
| 5-(4-Fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid |