4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine
Modify Date: 2025-11-30 11:19:37
4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 433254-87-6 | Molecular Weight | 232.34500 | |
| Density | 1.131g/cm3 | Boiling Point | 407.4ºC at 760 mmHg | |
| Molecular Formula | C13H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | 4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 407.4ºC at 760 mmHg |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.34500 |
| Flash Point | 200.2ºC |
| Exact Mass | 232.10300 |
| PSA | 67.15000 |
| LogP | 4.23440 |
| Index of Refraction | 1.603 |
| InChIKey | BFIWRBLVPZXIAN-UHFFFAOYSA-N |
| SMILES | CCCc1sc(N)nc1-c1ccc(C)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| hms2347g21 |