N-(3-iodophenyl)-2-(4-propan-2-ylphenoxy)acetamide
Modify Date: 2025-11-23 10:45:29
N-(3-iodophenyl)-2-(4-propan-2-ylphenoxy)acetamide structure
|
Common Name | N-(3-iodophenyl)-2-(4-propan-2-ylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 432509-06-3 | Molecular Weight | 395.23500 | |
| Density | 1.502g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C17H18INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | N-(3-iodophenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|
| Density | 1.502g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Molecular Formula | C17H18INO2 |
| Molecular Weight | 395.23500 |
| Flash Point | 268.8ºC |
| Exact Mass | 395.03800 |
| PSA | 38.33000 |
| LogP | 4.50510 |
| Index of Refraction | 1.632 |
| InChIKey | IGPXZKGUXUJAEL-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2cccc(I)c2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |