7-(6-aminopurin-9-yl)heptanenitrile structure
|
Common Name | 7-(6-aminopurin-9-yl)heptanenitrile | ||
|---|---|---|---|---|
| CAS Number | 4323-12-0 | Molecular Weight | 244.29600 | |
| Density | 1.3g/cm3 | Boiling Point | 518.9ºC at 760 mmHg | |
| Molecular Formula | C12H16N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.6ºC | |
| Name | 7-(6-aminopurin-9-yl)heptanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760 mmHg |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.29600 |
| Flash Point | 267.6ºC |
| Exact Mass | 244.14400 |
| PSA | 93.41000 |
| LogP | 2.46378 |
| Index of Refraction | 1.666 |
| InChIKey | KWDQTUVRXZJCAY-UHFFFAOYSA-N |
| SMILES | N#CCCCCCCn1cnc2c(N)ncnc21 |
| HS Code | 2933990090 |
|---|
|
~29%
7-(6-aminopurin... CAS#:4323-12-0 |
| Literature: Pini; Rossi; Cornaglia Ferraris; Stradi Bollettino Chimico Farmaceutico, 2000 , vol. 139, # 3 p. 107 - 113 |
|
~%
7-(6-aminopurin... CAS#:4323-12-0 |
| Literature: Pini; Rossi; Cornaglia Ferraris; Stradi Bollettino Chimico Farmaceutico, 2000 , vol. 139, # 3 p. 107 - 113 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Amino-9H-purin-9-yl-heptanonitril |