sodium,1,3-benzodioxol-5-yl(hydroxy)methanesulfonate
Modify Date: 2025-08-30 13:04:23
sodium,1,3-benzodioxol-5-yl(hydroxy)methanesulfonate structure
|
Common Name | sodium,1,3-benzodioxol-5-yl(hydroxy)methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 4321-64-6 | Molecular Weight | 254.19200 | |
| Density | 1.483g/cm3 | Boiling Point | 394.1ºC at 760 mmHg | |
| Molecular Formula | C8H7NaO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | sodium,1,3-benzodioxol-5-yl(hydroxy)methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760 mmHg |
| Molecular Formula | C8H7NaO6S |
| Molecular Weight | 254.19200 |
| Flash Point | 192.1ºC |
| Exact Mass | 253.98600 |
| PSA | 104.27000 |
| LogP | 1.03220 |
| Index of Refraction | 1.612 |
| InChIKey | LNGYYGXBMGRUKZ-UHFFFAOYSA-N |
| SMILES | COP(O)(=S)Oc1ccc([N+](=O)[O-])c(C)c1 |
| HS Code | 2920190090 |
|---|
|
~%
sodium,1,3-benz... CAS#:4321-64-6 |
| Literature: Shao-Yong, Wu; Eto, Morifusa Agricultural and Biological Chemistry, 1984 , vol. 48, # 12 p. 3071 - 3080 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| demethyl fenitrothion |
| desmethylfenitrothion |
| EINECS 253-556-3 |
| 1,3-benzodioxole-5-methanesulfonic acid,|A-hydroxy-,monosodium salt |