Tris(4-bromophenyl)amine structure
|
Common Name | Tris(4-bromophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 4316-58-9 | Molecular Weight | 482.007 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 514.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H12Br3N | Melting Point | 141-143 °C(lit.) | |
| MSDS | USA | Flash Point | 265.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tris(4-bromophenyl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.9±45.0 °C at 760 mmHg |
| Melting Point | 141-143 °C(lit.) |
| Molecular Formula | C18H12Br3N |
| Molecular Weight | 482.007 |
| Flash Point | 265.2±28.7 °C |
| Exact Mass | 478.851959 |
| PSA | 3.24000 |
| LogP | 8.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | ZRXVCYGHAUGABY-UHFFFAOYSA-N |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| Storage condition | Refrigerator |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921499090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Design of donor-acceptor star-shaped oligomers for efficient solution-processible organic photovoltaics.
Faraday Discuss. 174 , 313-39, (2014) This contribution describes recent progress in the design, synthesis and properties of solution-processible star-shaped oligomers and their application in organic photovoltaics. Even though alternativ... |
|
|
Synthesis of luminescent covalent-organic polymers for detecting nitroaromatic explosives and small organic molecules.
Macromol. Rapid Commun. 33(14) , 1184-90, (2012) Three porous luminescent covalent--organic polymers (COPs) have been synthesized through self-polycondensation of the monomers of tris(4-bromophenyl)amine, 1,3,5-tris(4-bromophenyl)benzene, and 2,4,6-... |
| Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)- |
| tris(p-bromophenyl)amine |
| 4,4',4''-Nitrilotris(1-bromobenzene) |
| Tris(4-bromophenyl)amine |
| tri(4-bromophenyl)amine |
| 4-Bromo-N,N-bis(4-bromophenyl)aniline |
| TRIS(4-BROMOPHENYL)AMIN |
| 4-broManyl-N,N-bis(4-broMophenyl)aniline |
| N,N-Bis(4-bromophenyl)-4-bromoaniline |
| 4,4',4''-tris(4-bromophenyl)amine |
| 4,4',4'-tribromotriphenylamine |
| MFCD00009665 |