8-hydroxy-1,3,7-trimethyl-8,9-dihydropurine-2,6-dione
Modify Date: 2025-11-26 11:23:25
8-hydroxy-1,3,7-trimethyl-8,9-dihydropurine-2,6-dione structure
|
Common Name | 8-hydroxy-1,3,7-trimethyl-8,9-dihydropurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 43146-65-2 | Molecular Weight | 212.20600 | |
| Density | 1.55g/cm3 | Boiling Point | 378.5ºC at 760 mmHg | |
| Molecular Formula | C8H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 8-hydroxy-1,3,7-trimethyl-8,9-dihydropurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 378.5ºC at 760 mmHg |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.20600 |
| Flash Point | 182.7ºC |
| Exact Mass | 212.09100 |
| PSA | 79.50000 |
| Index of Refraction | 1.678 |
| InChIKey | LSSRXYJELYKXQJ-UHFFFAOYSA-N |
| SMILES | CN1c2c(n(C)c(=O)n(C)c2=O)NC1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,7-Trimethyldihydrouric acid |
| 8-hydroxy-1,3,7-trimethyl-3,7,8,9-tetrahydro-1H-purine-2,6-dione |
| 3,7,8,9-Tetrahydro-8-hydroxy-1,3,7-trimethyl-1H-purine-2,6-dione |