1,2,4-Oxadiazole,3,5-bis(1,1,2,2,3,3,3-heptafluoropropyl)- structure
|
Common Name | 1,2,4-Oxadiazole,3,5-bis(1,1,2,2,3,3,3-heptafluoropropyl)- | ||
|---|---|---|---|---|
| CAS Number | 4314-46-9 | Molecular Weight | 406.07600 | |
| Density | 1.724g/cm3 | Boiling Point | 143.4ºC at 760mmHg | |
| Molecular Formula | C8F14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 40.5ºC | |
| Name | 3,5-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.724g/cm3 |
|---|---|
| Boiling Point | 143.4ºC at 760mmHg |
| Molecular Formula | C8F14N2O |
| Molecular Weight | 406.07600 |
| Flash Point | 40.5ºC |
| Exact Mass | 405.97900 |
| PSA | 38.92000 |
| LogP | 4.64840 |
| Index of Refraction | 1.302 |
| InChIKey | QLZJEMNNZRGUSV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1noc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
|
~%
1,2,4-Oxadiazol... CAS#:4314-46-9 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
|
~%
1,2,4-Oxadiazol... CAS#:4314-46-9 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-Bis-<1,1,2,2,3,3,3-heptafluor-propyl>-1,2,4-oxadiazol |