2,2,3,3,4,4-Hexafluoro-N(1),N(5)-dihydroxypentanediimidamide
Modify Date: 2025-09-29 05:02:32
2,2,3,3,4,4-Hexafluoro-N(1),N(5)-dihydroxypentanediimidamide structure
|
Common Name | 2,2,3,3,4,4-Hexafluoro-N(1),N(5)-dihydroxypentanediimidamide | ||
|---|---|---|---|---|
| CAS Number | 4314-39-0 | Molecular Weight | 268.11700 | |
| Density | 1.85g/cm3 | Boiling Point | 339ºC at 760 mmHg | |
| Molecular Formula | C5H6F6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | 2,2,3,3,4,4-hexafluoro-1-N',5-N'-dihydroxypentanediimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.85g/cm3 |
|---|---|
| Boiling Point | 339ºC at 760 mmHg |
| Molecular Formula | C5H6F6N4O2 |
| Molecular Weight | 268.11700 |
| Flash Point | 158.8ºC |
| Exact Mass | 268.03900 |
| PSA | 112.22000 |
| LogP | 1.78570 |
| Index of Refraction | 1.44 |
| InChIKey | CDWHNJLCCKBYEX-UHFFFAOYSA-N |
| SMILES | NC(=NO)C(F)(F)C(F)(F)C(F)(F)C(N)=NO |
|
~%
2,2,3,3,4,4-Hex... CAS#:4314-39-0 |
| Literature: Brown,H.C.; Wetzel,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3734 - 3738 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2',3,3',4,4'-Hexachlorobiphenyl ether |
| 2,2,3,3,4,4-hexafluoro-N,N'-dihydroxy-pentanediimidic acid diamide |
| 2,2',3,3',4,4'-hexachlorodiphenyl ether |
| 2,2,3,3,4,4-Hexafluor-glutarsaeure-diamidoxim |
| 2,2',3,4',4,4'-Hexachlordiphenylether |
| 2,2',3,3',4',4'-Hexachlordiphenylether |
| Perfluor-glutarsaeureamidoxim |