1-methyl-3,5-diphenylpyridin-4-one structure
|
Common Name | 1-methyl-3,5-diphenylpyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 43121-60-4 | Molecular Weight | 261.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-3,5-diphenylpyridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO |
|---|---|
| Molecular Weight | 261.31800 |
| Exact Mass | 261.11500 |
| PSA | 22.00000 |
| LogP | 3.71930 |
| InChIKey | LZQWXHXEBCOWNT-UHFFFAOYSA-N |
| SMILES | Cn1cc(-c2ccccc2)c(=O)c(-c2ccccc2)c1 |
|
~%
1-methyl-3,5-di... CAS#:43121-60-4 |
| Literature: Eli Lilly and Company Patent: US4152136 A1, 1979 ; |
|
~%
1-methyl-3,5-di... CAS#:43121-60-4 |
| Literature: Eli Lilly and Company Patent: US4152136 A1, 1979 ; |
|
~%
Detail
|
| Literature: Eli Lilly and Company Patent: US4152136 A1, 1979 ; |
| 1-methyl-3,5-diphenyl-1H-pyridin-4-one |
| N-Methyl-3,5-diphenyl-4-pyridon |
| 1-Methyl-3,5-diphenyl-4-piperidon |
| 1-Methyl-3,5-diphenyl-4-pyridon |