N-[4-(4-butylanilino)-9,10-dioxoanthracen-1-yl]benzamide
Modify Date: 2025-11-27 18:31:16
![N-[4-(4-butylanilino)-9,10-dioxoanthracen-1-yl]benzamide Structure](https://image.chemsrc.com/caspic/011/43096-12-4.png)
N-[4-(4-butylanilino)-9,10-dioxoanthracen-1-yl]benzamide structure
|
Common Name | N-[4-(4-butylanilino)-9,10-dioxoanthracen-1-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 43096-12-4 | Molecular Weight | 474.55000 | |
| Density | 1.283g/cm3 | Boiling Point | 605ºC at 760 mmHg | |
| Molecular Formula | C31H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | N-[4-(4-butylanilino)-9,10-dioxoanthracen-1-yl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 605ºC at 760 mmHg |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.55000 |
| Flash Point | 160ºC |
| Exact Mass | 474.19400 |
| PSA | 78.76000 |
| LogP | 7.25750 |
| Index of Refraction | 1.69 |
| InChIKey | FBGVWUGZXVWYLN-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(Nc2ccc(NC(=O)c3ccccc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 256-088-8 |
| N-p-nitrobenzenesulfonyl aziridine |
| N-nosylaziridine |