1-(3,4-dihydroxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone
Modify Date: 2025-09-13 11:55:36
1-(3,4-dihydroxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone structure
|
Common Name | 1-(3,4-dihydroxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone | ||
|---|---|---|---|---|
| CAS Number | 430447-82-8 | Molecular Weight | 290.33800 | |
| Density | 1.41g/cm3 | Boiling Point | 561.6ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
| Name | 1-(3,4-dihydroxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 561.6ºC at 760 mmHg |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.33800 |
| Flash Point | 293.5ºC |
| Exact Mass | 290.07300 |
| PSA | 108.61000 |
| LogP | 2.47960 |
| Index of Refraction | 1.668 |
| InChIKey | JQXFBAGVXOGSNK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(SCC(=O)c2ccc(O)c(O)c2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
1-(3,4-dihydrox... CAS#:430447-82-8 |
| Literature: Lanier, Marion; Sergienko, Eduard; Simao, Ana Maria; Su, Ying; Chung, Thomas; Millan, Jose Luis; Cashman, John R. Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 2 p. 573 - 579 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |