3-Methyl-6-(2-phenylvinyl)(1,2,4)triazolo(3,4-b)(1,3,4)thiadiazole structure
|
Common Name | 3-Methyl-6-(2-phenylvinyl)(1,2,4)triazolo(3,4-b)(1,3,4)thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 43029-39-6 | Molecular Weight | 242.30000 | |
| Density | 1.35g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-6-[(E)-2-phenylethenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.30000 |
| Exact Mass | 242.06300 |
| PSA | 71.32000 |
| LogP | 2.66460 |
| Index of Refraction | 1.724 |
| InChIKey | JKPVTJJPEOVAHM-BQYQJAHWSA-N |
| SMILES | Cc1nnc2sc(C=Cc3ccccc3)nn12 |
| HS Code | 2934999090 |
|---|
|
~%
3-Methyl-6-(2-p... CAS#:43029-39-6 |
| Literature: Golgolab; Lalezari; Hosseini Gohari Journal of Heterocyclic Chemistry, 1973 , vol. 10, # 3 p. 387 - 390 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-6-(2-phenylvinyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| 3-methyl-6-styryl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |