Fmoc-Nalpha-methyl-O-benzyl-L-tyrosine
Modify Date: 2025-09-15 18:02:42
Fmoc-Nalpha-methyl-O-benzyl-L-tyrosine structure
|
Common Name | Fmoc-Nalpha-methyl-O-benzyl-L-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 428868-52-4 | Molecular Weight | 507.57600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Fmoc-Nalpha-methyl-O-benzyl-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H29NO5 |
|---|---|
| Molecular Weight | 507.57600 |
| Exact Mass | 507.20500 |
| PSA | 76.07000 |
| LogP | 6.14220 |
| InChIKey | PWRIYHZWFNFNDD-PMERELPUSA-N |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| HS Code | 2922509090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:519156-39-9
CAS#:71989-40-7| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(carbomethoxy)-3-ethyl-1,2,5,6-tetrahydropyridine |
| methyl 5-ethyl-3,6-dihydro-1(2H)-pyridinecarboxylate |
| N-(9H-fluoren-9-ylmethoxycarbonyl)-N-methyl-L-tyrosine-O-benzyl ether |
| 3-ethyl-1,2,5,6-tetrahydro-pyridine-1-carboxylic acid methyl ester |
| 3-ethyl-1-methoxycarbonyl-1,2,5,6-tetrahydropyridine |
| N-(carbonyl-9H-fluoren-9-ylmethoxy)-N-methyl-L-tyrosine-O-benzyl ether |
| 1-carbomethoxy-3-ethyl-1,2,5,6-tetrahydropyridine |
| 1(2H)-Pyridinecarboxylic acid,3-ethyl-5,6-dihydro-,methyl ester |