1-(4-butylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde structure
|
Common Name | 1-(4-butylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 428853-87-6 | Molecular Weight | 255.35500 | |
| Density | 1g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.8ºC | |
| Name | 1-(4-butylphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.35500 |
| Flash Point | 190.8ºC |
| Exact Mass | 255.16200 |
| PSA | 22.00000 |
| LogP | 4.24920 |
| Index of Refraction | 1.541 |
| InChIKey | MGJFOUBVHSCMIL-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(-n2c(C)cc(C=O)c2C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |