9H-Fluoren-9-one,3-methoxy-2-methyl-
Modify Date: 2025-09-22 07:39:56
9H-Fluoren-9-one,3-methoxy-2-methyl- structure
|
Common Name | 9H-Fluoren-9-one,3-methoxy-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 42839-91-8 | Molecular Weight | 224.25500 | |
| Density | 1.211g/cm3 | Boiling Point | 404.6ºC at 760mmHg | |
| Molecular Formula | C15H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 3-methoxy-2-methylfluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760mmHg |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.25500 |
| Flash Point | 194ºC |
| Exact Mass | 224.08400 |
| PSA | 26.30000 |
| LogP | 3.21500 |
| Index of Refraction | 1.624 |
| InChIKey | HQULSBFZRSUNDA-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C)C(=O)c1ccccc1-2 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Methyl-3-methoxyfluorenon |
| 3-methoxy-2-methyl-9h-fluoren-9-one |