2,4,6-trimethoxybenzoyl chloride
Modify Date: 2025-08-25 08:48:22
2,4,6-trimethoxybenzoyl chloride structure
|
Common Name | 2,4,6-trimethoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 42833-84-1 | Molecular Weight | 230.64500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-trimethoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11ClO4 |
|---|---|
| Molecular Weight | 230.64500 |
| Exact Mass | 230.03500 |
| PSA | 44.76000 |
| LogP | 2.09140 |
| InChIKey | XVXFMSXONCJZEB-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)Cl)c(OC)c1 |
|
~%
2,4,6-trimethox... CAS#:42833-84-1 |
| Literature: Ferranti; Roberti; Garuti; Giovanninetti; Mannini Palenzona Pharmazie, 1988 , vol. 43, # 5 p. 359 - 360 |
|
~%
2,4,6-trimethox... CAS#:42833-84-1 |
| Literature: Lloyd; Whalley Journal of the Chemical Society, 1956 , p. 3209,3211 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzoyl chloride,2,4,6-trimethoxy |
| 2,4,6-Trimethoxy-benzoylchlorid |
| 2,4,6-trimethoxy-benzoyl chloride |