ethyl 2-(4-hydroxyphenoxy)-2-methyl-propanoate
Modify Date: 2025-08-25 08:08:56
ethyl 2-(4-hydroxyphenoxy)-2-methyl-propanoate structure
|
Common Name | ethyl 2-(4-hydroxyphenoxy)-2-methyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 42806-90-6 | Molecular Weight | 224.25300 | |
| Density | 1.132g/cm3 | Boiling Point | 335.1ºC at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8ºC | |
| Name | ethyl 2-(4-hydroxyphenoxy)-2-methylpropanoate |
|---|
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 335.1ºC at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 123.8ºC |
| Exact Mass | 224.10500 |
| PSA | 55.76000 |
| LogP | 2.11270 |
| Index of Refraction | 1.515 |
| InChIKey | GYPAUSRXYPLNAP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(O)cc1 |
| HS Code | 2918990090 |
|---|
|
~94%
ethyl 2-(4-hydr... CAS#:42806-90-6 |
| Literature: Masson, Christophe; Caumont-Bertrand, Karine Patent: US2011/195993 A1, 2011 ; Location in patent: Page/Page column 12; 20 ; US 20110195993 A1 |
|
~40%
ethyl 2-(4-hydr... CAS#:42806-90-6 |
| Literature: Pierre Fabre Medicament Patent: US2008/167313 A1, 2008 ; Location in patent: Page/Page column 15-16 ; |
|
~34%
ethyl 2-(4-hydr... CAS#:42806-90-6 |
| Literature: Oelschlaeger; Rothley; Hellwich; Schmidt Archiv der Pharmazie, 1989 , vol. 322, # 6 p. 337 - 342 |
|
~%
ethyl 2-(4-hydr... CAS#:42806-90-6 |
| Literature: Masson, Christophe; Caumont-Bertrand, Karine Patent: US2011/195993 A1, 2011 ; US 20110195993 A1 |
CAS#:67648-64-0| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |